Products 1227578-46-2
CAS 1227578-46-2 is the registry number for 6-Bromo-3-fluoro-2-(trifluoromethyl)pyridine. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 50mg, 0,5g.
6-bromo-3-fluoro-2-(trifluoromethyl)pyridine (CAS 1227578-46-2) is a chemical compound with the molecular formula C6H2BrF4N and a molecular weight of 243.98 g/mol. IUPAC name: 6-bromo-3-fluoro-2-(trifluoromethyl)pyridine. InChIKey: NEMDVTHUXJKSDX-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF4N |
|---|---|
| Molecular weight | 243.98 g/mol |
| IUPAC name | 6-bromo-3-fluoro-2-(trifluoromethyl)pyridine |
| InChIKey | NEMDVTHUXJKSDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1F)C(F)(F)F)Br |
Computed by PubChem (NCBI)