CAS 17823-49-3 is the registry number for 3-Bromo-2,4,5,6-tetrafluoroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2,4,5,6-tetrafluoroaniline (CAS 17823-49-3) is a chemical compound with the molecular formula C6H2BrF4N and a molecular weight of 243.98 g/mol. IUPAC name: 3-bromo-2,4,5,6-tetrafluoroaniline. InChIKey: KIZJYHOTMUSLBY-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF4N |
|---|---|
| Molecular weight | 243.98 g/mol |
| IUPAC name | 3-bromo-2,4,5,6-tetrafluoroaniline |
| InChIKey | KIZJYHOTMUSLBY-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)Br)F)F)F)N |
Computed by PubChem (NCBI)