Products 1245914-35-5
CAS 1245914-35-5 is the registry number for 3-Bromo-5-fluoro-2-(trifluoromethyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-5-fluoro-2-(trifluoromethyl)pyridine (CAS 1245914-35-5) is a chemical compound with the molecular formula C6H2BrF4N and a molecular weight of 243.98 g/mol. IUPAC name: 3-bromo-5-fluoro-2-(trifluoromethyl)pyridine. InChIKey: RRRFJEMWVAWRIX-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF4N |
|---|---|
| Molecular weight | 243.98 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-(trifluoromethyl)pyridine |
| InChIKey | RRRFJEMWVAWRIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)C(F)(F)F)F |
Computed by PubChem (NCBI)