Products 1227579-47-6
CAS 1227579-47-6 is the registry number for Ethyl 6-fluoro-2-methylnicotinate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 6-fluoro-2-methylpyridine-3-carboxylate (CAS 1227579-47-6) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: ethyl 6-fluoro-2-methylpyridine-3-carboxylate. InChIKey: GAYOMNUBOBEYLE-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | ethyl 6-fluoro-2-methylpyridine-3-carboxylate |
| InChIKey | GAYOMNUBOBEYLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)F)C |
Computed by PubChem (NCBI)