Products 1227592-37-1
CAS 1227592-37-1 is the registry number for 2-(5-Bromo-2-chloropyridin-4-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(5-bromo-2-chloro-4-pyridinyl)acetic acid (CAS 1227592-37-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 2-(5-bromo-2-chloro-4-pyridinyl)acetic acid. InChIKey: LSQMBAZKEAYRDD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 2-(5-bromo-2-chloro-4-pyridinyl)acetic acid |
| InChIKey | LSQMBAZKEAYRDD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Br)CC(=O)O |
Computed by PubChem (NCBI)