Products 1227594-55-9
CAS 1227594-55-9 appears in our catalog under these names: 4-Bromomethyl-2-hydroxy-6-(trifluoromethyl)pyridine, 95%, 4–Bromomethyl–2–hydroxy–6–(trifluoromethyl)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
4-(bromomethyl)-6-(trifluoromethyl)-1H-pyridin-2-one (CAS 1227594-55-9) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 4-(bromomethyl)-6-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: MNPKWBVTRDWMQU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 4-(bromomethyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | MNPKWBVTRDWMQU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(NC1=O)C(F)(F)F)CBr |
Computed by PubChem (NCBI)