CAS 122772-16-1 is the registry number for 3-(4-Hydroxy-3-methoxyphenyl)-4-(4-tolyl)-1,2,4-triazoline-5-thione. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-(4-hydroxy-3-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (CAS 122772-16-1) is a chemical compound with the molecular formula C16H15N3O2S and a molecular weight of 313.4 g/mol. IUPAC name: 3-(4-hydroxy-3-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: SSADWHDYVOIWLE-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 3-(4-hydroxy-3-methoxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | SSADWHDYVOIWLE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=NNC2=S)C3=CC(=C(C=C3)O)OC |
Computed by PubChem (NCBI)