Products 773152-30-0
CAS 773152-30-0 is the registry number for 3-Amino-N-(3-hydroxyphenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-N-(3-hydroxyphenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CAS 773152-30-0) is a chemical compound with the molecular formula C16H15N3O2S and a molecular weight of 313.4 g/mol. IUPAC name: 3-amino-N-(3-hydroxyphenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: PUKSHWUICBPTQE-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 3-amino-N-(3-hydroxyphenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | PUKSHWUICBPTQE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)NC3=CC(=CC=C3)O)N)C |
Computed by PubChem (NCBI)