CAS 438030-43-4 is the registry number for [5-(4-Nitro-phenyl)-4,5-dihydro-thiazol-2-yl]-o-tolyl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-(2-methylphenyl)-5-(4-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine (CAS 438030-43-4) is a chemical compound with the molecular formula C16H15N3O2S and a molecular weight of 313.4 g/mol. IUPAC name: N-(2-methylphenyl)-5-(4-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine. InChIKey: UZULWBMACAOYNU-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | N-(2-methylphenyl)-5-(4-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| InChIKey | UZULWBMACAOYNU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC2=NCC(S2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)