Products 1228092-36-1

CAS 1228092-36-1 is the registry number for tert–butyl cis–(2–(4–bromophenyl)cyclopropyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1R,2R)-2-(4-bromophenyl)cyclopropyl]carbamate (CAS 1228092-36-1) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-(4-bromophenyl)cyclopropyl]carbamate. InChIKey: ATYDSIJHMSGNKM-VXGBXAGGSA-N.

Identity
Molecular formulaC14H18BrNO2
Molecular weight312.20 g/mol
IUPAC nametert-butyl N-[(1R,2R)-2-(4-bromophenyl)cyclopropyl]carbamate
InChIKeyATYDSIJHMSGNKM-VXGBXAGGSA-N
SMILESCC(C)(C)OC(=O)N[C@@H]1C[C@@H]1C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)