CAS 907196-12-7 is the registry number for (1R,2S)-[2-(4-Bromo-phenyl)-cyclopropyl]-carbamicacidtert-butylester, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]carbamate (CAS 907196-12-7) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]carbamate. InChIKey: ATYDSIJHMSGNKM-NWDGAFQWSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]carbamate |
| InChIKey | ATYDSIJHMSGNKM-NWDGAFQWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)