Products 907196-11-6
CAS 907196-11-6 appears in our catalog under these names: tert–butyl trans–(2–(4–bromophenyl)cyclopropyl)carbamate, tert-Butyl ((1S,2R)-2-(4-bromophenyl)cyclopropyl)carbamate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(1S,2R)-2-(4-bromophenyl)cyclopropyl]carbamate (CAS 907196-11-6) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-(4-bromophenyl)cyclopropyl]carbamate. InChIKey: ATYDSIJHMSGNKM-NEPJUHHUSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-(4-bromophenyl)cyclopropyl]carbamate |
| InChIKey | ATYDSIJHMSGNKM-NEPJUHHUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)