CAS 1228182-44-2 appears in our catalog under these names: Cimaterol-d7, Cimaterol-d7, >95% (HPLC), Cimaterol D7, (±)-Cimaterol-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, Cimaterol–d7. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 500μg, 5mg, 5 mg.
2-amino-5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzonitrile (CAS 1228182-44-2) is a chemical compound with the molecular formula C12H17N3O and a molecular weight of 226.33 g/mol. IUPAC name: 2-amino-5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzonitrile. InChIKey: BUXRLJCGHZZYNE-UNAVHCQLSA-N.
| Molecular formula | C12H17N3O |
|---|---|
| Molecular weight | 226.33 g/mol |
| IUPAC name | 2-amino-5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzonitrile |
| InChIKey | BUXRLJCGHZZYNE-UNAVHCQLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C=C1)N)C#N)O |
Computed by PubChem (NCBI)