CAS 1228557-50-3 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-2-(m-tolyl)acetic acid, 95%, (R)–2–((tert–Butoxycarbonyl)amino)–2–(m–tolyl)acetic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g.
(2R)-2-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1228557-50-3) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-2-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: KLVVTGRHRBWUAO-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-2-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | KLVVTGRHRBWUAO-LLVKDONJSA-N |
| SMILES | CC1=CC(=CC=C1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)