Products 1228561-35-0
CAS 1228561-35-0 is the registry number for (R)-2-(2,3-Dichlorophenyl)pyrrolidine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(2,3-dichlorophenyl)pyrrolidine (CAS 1228561-35-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: (2R)-2-(2,3-dichlorophenyl)pyrrolidine. InChIKey: HZVTWBMAMRYGPD-SECBINFHSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | (2R)-2-(2,3-dichlorophenyl)pyrrolidine |
| InChIKey | HZVTWBMAMRYGPD-SECBINFHSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)