CAS 1228572-17-5 is the registry number for N-[(Z)-Amino(2,4-dioxodihydrofuran-3(2h)-ylidene)methyl]benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-[amino-(3-hydroxy-5-oxo-2H-furan-4-yl)methylidene]benzamide (CAS 1228572-17-5) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: N-[amino-(3-hydroxy-5-oxo-2H-furan-4-yl)methylidene]benzamide. InChIKey: NTMZQUDDBRMXGA-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | N-[amino-(3-hydroxy-5-oxo-2H-furan-4-yl)methylidene]benzamide |
| InChIKey | NTMZQUDDBRMXGA-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C(=NC(=O)C2=CC=CC=C2)N)O |
Computed by PubChem (NCBI)