CAS 959047-57-5 is the registry number for Trimetazidine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,5-trihydroxy-N-pyridin-3-ylbenzamide (CAS 959047-57-5) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 3,4,5-trihydroxy-N-pyridin-3-ylbenzamide. InChIKey: SRBSVSZXNSNTCU-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 3,4,5-trihydroxy-N-pyridin-3-ylbenzamide |
| InChIKey | SRBSVSZXNSNTCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NC(=O)C2=CC(=C(C(=C2)O)O)O |
Computed by PubChem (NCBI)