Products 67387-54-6
CAS 67387-54-6 appears in our catalog under these names: 3-[(5-Methyl-1,2-oxazole-4-)amido]benzoic acid, 95%, 3-(5-Methylisoxazole-4-carboxamido)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid (CAS 67387-54-6) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid. InChIKey: ROGQUCAEHRKRME-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid |
| InChIKey | ROGQUCAEHRKRME-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)