Products 122864-95-3
CAS 122864-95-3 is the registry number for (4-Nitrophenyl)-D-glutamine hydrate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-5-amino-2-(4-nitroanilino)-5-oxopentanoic acid;hydrate (CAS 122864-95-3) is a chemical compound with the molecular formula C11H15N3O6 and a molecular weight of 285.25 g/mol. IUPAC name: (2R)-5-amino-2-(4-nitroanilino)-5-oxopentanoic acid;hydrate. InChIKey: INUJXIXXPNQEJX-SBSPUUFOSA-N.
| Molecular formula | C11H15N3O6 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2R)-5-amino-2-(4-nitroanilino)-5-oxopentanoic acid;hydrate |
| InChIKey | INUJXIXXPNQEJX-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1N[C@H](CCC(=O)N)C(=O)O)[N+](=O)[O-].O |
Computed by PubChem (NCBI)