Products 239083-73-9
CAS 239083-73-9 is the registry number for (1E)-D-Arabinose-(2-nitrophenyl)hydrazone. Offered by: TRC. Available pack sizes: 500mg.
(2R,3S,4R,5E)-5-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol (CAS 239083-73-9) is a chemical compound with the molecular formula C11H15N3O6 and a molecular weight of 285.25 g/mol. IUPAC name: (2R,3S,4R,5E)-5-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol. InChIKey: IXMUDTKTPHPTLK-WHPWLQEHSA-N.
| Molecular formula | C11H15N3O6 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2R,3S,4R,5E)-5-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol |
| InChIKey | IXMUDTKTPHPTLK-WHPWLQEHSA-N |
| SMILES | C1=CC=C(C(=C1)N/N=C/[C@H]([C@@H]([C@@H](CO)O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)