CAS 1294452-61-1 is the registry number for L(+)-(Arabinose 2-Nitrophenyl)hydrazone. Offered by: TRC. Available pack sizes: 500mg.
(2S,3R,4S,5E)-5-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol (CAS 1294452-61-1) is a chemical compound with the molecular formula C11H15N3O6 and a molecular weight of 285.25 g/mol. IUPAC name: (2S,3R,4S,5E)-5-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol. InChIKey: IXMUDTKTPHPTLK-KJFNLCDKSA-N.
| Molecular formula | C11H15N3O6 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2S,3R,4S,5E)-5-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol |
| InChIKey | IXMUDTKTPHPTLK-KJFNLCDKSA-N |
| SMILES | C1=CC=C(C(=C1)N/N=C/[C@@H]([C@H]([C@H](CO)O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)