CAS 1228666-35-0 is the registry number for 5-(5-(Benzyloxy)-6-bromopyridin-2-yl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(6-bromo-5-phenylmethoxy-2-pyridinyl)-1,3-oxazole (CAS 1228666-35-0) is a chemical compound with the molecular formula C15H11BrN2O2 and a molecular weight of 331.16 g/mol. IUPAC name: 5-(6-bromo-5-phenylmethoxy-2-pyridinyl)-1,3-oxazole. InChIKey: SNEXISSXLANPHT-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O2 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 5-(6-bromo-5-phenylmethoxy-2-pyridinyl)-1,3-oxazole |
| InChIKey | SNEXISSXLANPHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=C(C=C2)C3=CN=CO3)Br |
Computed by PubChem (NCBI)