CAS 1286753-90-9 is the registry number for benzyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 4-bromopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1286753-90-9) is a chemical compound with the molecular formula C15H11BrN2O2 and a molecular weight of 331.16 g/mol. IUPAC name: benzyl 4-bromopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: BKGBIPRQGVMMKN-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O2 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | benzyl 4-bromopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | BKGBIPRQGVMMKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N2C=CC3=C(C=CN=C32)Br |
Computed by PubChem (NCBI)