Products 331989-76-5
CAS 331989-76-5 is the registry number for 3-(4-Bromophenyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-(4-bromophenyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole (CAS 331989-76-5) is a chemical compound with the molecular formula C15H11BrN2O2 and a molecular weight of 331.16 g/mol. IUPAC name: 3-(4-bromophenyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: PWXVKWQJAHTEJE-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O2 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | PWXVKWQJAHTEJE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NO2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)