CAS 1228675-25-9 appears in our catalog under these names: 4-Benzyl 1-tert-butyl 2-oxopiperazine-1,4-dicarboxylate, 97%, 97%, 2-OXO-PIPERAZINE-1,4-DICARBOXYLIC ACID 4-BENZYL ESTER 1-TERT-BUTYL ESTER, 95%, 4-Benzyl 1-tert-butyl 2-oxopiperazine-1,4-dicarboxylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
4-O-benzyl 1-O-tert-butyl 2-oxopiperazine-1,4-dicarboxylate (CAS 1228675-25-9) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl 2-oxopiperazine-1,4-dicarboxylate. InChIKey: ZDJQTZMJNLNEGZ-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl 2-oxopiperazine-1,4-dicarboxylate |
| InChIKey | ZDJQTZMJNLNEGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)