Products 1228765-67-0
CAS 1228765-67-0 appears in our catalog under these names: Edaravone-d5, Edaravone D5, >95% (HPLC), Edaravone D5, Edaravone d5, Edaravone-d5, 99.76%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-4H-pyrazol-3-one (CAS 1228765-67-0) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 179.23 g/mol. IUPAC name: 5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-4H-pyrazol-3-one. InChIKey: QELUYTUMUWHWMC-VIQYUKPQSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | 5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-4H-pyrazol-3-one |
| InChIKey | QELUYTUMUWHWMC-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N2C(=O)CC(=N2)C)[2H])[2H] |
Computed by PubChem (NCBI)