CAS 923601-69-8 is the registry number for Atazanavir Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate (CAS 923601-69-8) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate. InChIKey: GFGQSTIUFXHAJS-OLZOCXBDSA-N.
| Molecular formula | C15H22ClNO3 |
|---|---|
| Molecular weight | 299.79 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| InChIKey | GFGQSTIUFXHAJS-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)[C@H](CCl)O |
Computed by PubChem (NCBI)