Products 923601-69-8

CAS 923601-69-8 is the registry number for Atazanavir Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate (CAS 923601-69-8) is a chemical compound with the molecular formula C15H22ClNO3 and a molecular weight of 299.79 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate. InChIKey: GFGQSTIUFXHAJS-OLZOCXBDSA-N.

Identity
Molecular formulaC15H22ClNO3
Molecular weight299.79 g/mol
IUPAC nametert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-phenylbutan-2-yl]carbamate
InChIKeyGFGQSTIUFXHAJS-OLZOCXBDSA-N
SMILESCC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)[C@H](CCl)O

Computed by PubChem (NCBI)