CAS 122947-72-2 appears in our catalog under these names: 4-(Dibromomethyl)-3-nitrobenzonitrile, 95%, 4-(Dibromomethyl)-3-nitrobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-(dibromomethyl)-3-nitrobenzonitrile (CAS 122947-72-2) is a chemical compound with the molecular formula C8H4Br2N2O2 and a molecular weight of 319.94 g/mol. IUPAC name: 4-(dibromomethyl)-3-nitrobenzonitrile. InChIKey: QSNWGGZLZYPJJC-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2O2 |
|---|---|
| Molecular weight | 319.94 g/mol |
| IUPAC name | 4-(dibromomethyl)-3-nitrobenzonitrile |
| InChIKey | QSNWGGZLZYPJJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])C(Br)Br |
Computed by PubChem (NCBI)