CAS 1934767-12-0 is the registry number for 3-(3,5-Dibromophenyl)-1,2,4-oxadiazol-5-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3,5-dibromophenyl)-4H-1,2,4-oxadiazol-5-one (CAS 1934767-12-0) is a chemical compound with the molecular formula C8H4Br2N2O2 and a molecular weight of 319.94 g/mol. IUPAC name: 3-(3,5-dibromophenyl)-4H-1,2,4-oxadiazol-5-one. InChIKey: HLWVTGVKVZTFJK-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2O2 |
|---|---|
| Molecular weight | 319.94 g/mol |
| IUPAC name | 3-(3,5-dibromophenyl)-4H-1,2,4-oxadiazol-5-one |
| InChIKey | HLWVTGVKVZTFJK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)C2=NOC(=O)N2 |
Computed by PubChem (NCBI)