CAS 89891-77-0 appears in our catalog under these names: 6,7–dibromoquinoxaline–2,3(1H,4H)–dione, 6,7-Dibromo-1,4-dihydroquinoxaline-2,3-dione 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione (CAS 89891-77-0) is a chemical compound with the molecular formula C8H4Br2N2O2 and a molecular weight of 319.94 g/mol. IUPAC name: 6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione. InChIKey: FVXPGHAWNRHHJD-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2O2 |
|---|---|
| Molecular weight | 319.94 g/mol |
| IUPAC name | 6,7-dibromo-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | FVXPGHAWNRHHJD-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)