CAS 122994-74-5 appears in our catalog under these names: 8-Chloro-1,2,3,4-tetrahydroacridin-9-amine, 95%, 8-Chloro-1,2,3,4-tetrahydroacridin-9-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-chloro-1,2,3,4-tetrahydroacridin-9-amine (CAS 122994-74-5) is a chemical compound with the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. IUPAC name: 8-chloro-1,2,3,4-tetrahydroacridin-9-amine. InChIKey: KVGMGGLTJLJDFE-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2 |
|---|---|
| Molecular weight | 232.71 g/mol |
| IUPAC name | 8-chloro-1,2,3,4-tetrahydroacridin-9-amine |
| InChIKey | KVGMGGLTJLJDFE-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C(=CC=C3)Cl)C(=C2C1)N |
Computed by PubChem (NCBI)