Products 1231211-15-6
CAS 1231211-15-6 is the registry number for 2-(5-Bromothiophen-2-yl)-3-hydroxy-chromen-4-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-(5-bromothiophen-2-yl)-3-hydroxychromen-4-one (CAS 1231211-15-6) is a chemical compound with the molecular formula C13H7BrO3S and a molecular weight of 323.16 g/mol. IUPAC name: 2-(5-bromothiophen-2-yl)-3-hydroxychromen-4-one. InChIKey: JDTCPOTWWXDHRX-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO3S |
|---|---|
| Molecular weight | 323.16 g/mol |
| IUPAC name | 2-(5-bromothiophen-2-yl)-3-hydroxychromen-4-one |
| InChIKey | JDTCPOTWWXDHRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(O2)C3=CC=C(S3)Br)O |
Computed by PubChem (NCBI)