CAS 20077-15-0 is the registry number for 2-Bromo-9H-thioxanthen-9-one 10,10-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-10,10-dioxothioxanthen-9-one (CAS 20077-15-0) is a chemical compound with the molecular formula C13H7BrO3S and a molecular weight of 323.16 g/mol. IUPAC name: 2-bromo-10,10-dioxothioxanthen-9-one. InChIKey: PIPWXKDJFFRUES-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO3S |
|---|---|
| Molecular weight | 323.16 g/mol |
| IUPAC name | 2-bromo-10,10-dioxothioxanthen-9-one |
| InChIKey | PIPWXKDJFFRUES-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2(=O)=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)