CAS 327078-63-7 appears in our catalog under these names: 7-(4-Bromo-phenyl)-5-hydroxy-benzo[1,3]oxathiol-2-one, 95%, 7-(4-Bromophenyl)-5-hydroxy-2H-1,3-benzoxathiol-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
7-(4-bromophenyl)-5-hydroxy-1,3-benzoxathiol-2-one (CAS 327078-63-7) is a chemical compound with the molecular formula C13H7BrO3S and a molecular weight of 323.16 g/mol. IUPAC name: 7-(4-bromophenyl)-5-hydroxy-1,3-benzoxathiol-2-one. InChIKey: CQRIOEIVAKXNPL-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO3S |
|---|---|
| Molecular weight | 323.16 g/mol |
| IUPAC name | 7-(4-bromophenyl)-5-hydroxy-1,3-benzoxathiol-2-one |
| InChIKey | CQRIOEIVAKXNPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C(=CC(=C2)O)SC(=O)O3)Br |
Computed by PubChem (NCBI)