Products 123155-82-8
CAS 123155-82-8 appears in our catalog under these names: Ofloxacin EP Impurity B, Ofloxacin EP Impurity B (Decarboxyl Ofloxacin), Decarboxyl Ofloxacin, >95% (HPLC), (RS)-9-Fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-2,3-dihydro-7H-pyrido(1,2,3-de)-1,4-benzoxazin-7-one, Decarboxyl ofloxacin. Offered by: Chemat Brand, TRC, Mikromol, MedChemExpress. Available pack sizes: on request, 250mg, 25mg, 5mg, 100mg, 250 mg, 5 mg, 25 mg.
7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one (CAS 123155-82-8) is a chemical compound with the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. IUPAC name: 7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one. InChIKey: XTLCAWXSWVQNHK-UHFFFAOYSA-N.
| Molecular formula | C17H20FN3O2 |
|---|---|
| Molecular weight | 317.36 g/mol |
| IUPAC name | 7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
| InChIKey | XTLCAWXSWVQNHK-UHFFFAOYSA-N |
| SMILES | CC1COC2=C3N1C=CC(=O)C3=CC(=C2N4CCN(CC4)C)F |
Computed by PubChem (NCBI)