CAS 178964-53-9 appears in our catalog under these names: Levofloxacin EP Impurity E ((S)-Ofloxacin EP Impurity B, Decarboxyl Levofloxacin), Descarboxyl Levofloxacin Impurity, Descarboxyl Levofloxacin, >95% (HPLC), Levofloxacin Impurity B 95%, Levofloxacin impurity 6. Offered by: Chemat Brand, TRC, Ambeed, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5 mg.
(2S)-7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one (CAS 178964-53-9) is a chemical compound with the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. IUPAC name: (2S)-7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one. InChIKey: XTLCAWXSWVQNHK-NSHDSACASA-N.
| Molecular formula | C17H20FN3O2 |
|---|---|
| Molecular weight | 317.36 g/mol |
| IUPAC name | (2S)-7-fluoro-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
| InChIKey | XTLCAWXSWVQNHK-NSHDSACASA-N |
| SMILES | C[C@H]1COC2=C3N1C=CC(=O)C3=CC(=C2N4CCN(CC4)C)F |
Computed by PubChem (NCBI)