CAS 1773507-35-9 is the registry number for tert-Butyl 2-(4-fluorophenyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 1773507-35-9) is a chemical compound with the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. IUPAC name: tert-butyl 2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: ZQOIPGSEVMBJDP-UHFFFAOYSA-N.
| Molecular formula | C17H20FN3O2 |
|---|---|
| Molecular weight | 317.36 g/mol |
| IUPAC name | tert-butyl 2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | ZQOIPGSEVMBJDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=CC(=N2)C3=CC=C(C=C3)F)C1 |
Computed by PubChem (NCBI)