CAS 123185-91-1 is the registry number for Pitavastatin Impurity 76. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 123185-91-1) is a chemical compound with the molecular formula C9H14O5 and a molecular weight of 202.20 g/mol. IUPAC name: 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: HCQRTPSDEFPKCT-RQJHMYQMSA-N.
| Molecular formula | C9H14O5 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | 2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| InChIKey | HCQRTPSDEFPKCT-RQJHMYQMSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)C=O)CC(=O)O)C |
Computed by PubChem (NCBI)