CAS 57822-06-7 appears in our catalog under these names: 5-Oxoazelaic acid, 95%, 5–Oxoazelaic Acid, 5-Oxoazelaic Acid, >96.0%(GC)(T), 5-Oxononanedioic acid, 95%, 95%, 5-Oxononanedioic acid, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 200mg, 100mg.
5-oxononanedioic acid (CAS 57822-06-7) is a chemical compound with the molecular formula C9H14O5 and a molecular weight of 202.20 g/mol. IUPAC name: 5-oxononanedioic acid. InChIKey: GTCHZEFRDKAINX-UHFFFAOYSA-N.
| Molecular formula | C9H14O5 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | 5-oxononanedioic acid |
| InChIKey | GTCHZEFRDKAINX-UHFFFAOYSA-N |
| SMILES | C(CC(=O)CCCC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)