Products 1506-55-4

CAS 1506-55-4 appears in our catalog under these names: Monoethyl 4–Oxoheptanedioate, Monoethyl 4-Oxoheptanedioate, >97.0%(T), 3-Oxopentane-1,5-dicarboxylic acid monoethyl ester, 95%, 3-Oxopentane-1,5-dicarboxylic acid monoethyl ester, 98%, 98%, 7-Ethoxy-4,7-dioxoheptanoic acid, 98%(GC-MS),RG. Offered by: GLPBio, TCI, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.

Structural formula: {0} (CAS {1})

7-ethoxy-4,7-dioxoheptanoic acid (CAS 1506-55-4) is a chemical compound with the molecular formula C9H14O5 and a molecular weight of 202.20 g/mol. IUPAC name: 7-ethoxy-4,7-dioxoheptanoic acid. InChIKey: JYEYJELELKLPLO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O5
Molecular weight202.20 g/mol
IUPAC name7-ethoxy-4,7-dioxoheptanoic acid
InChIKeyJYEYJELELKLPLO-UHFFFAOYSA-N
SMILESCCOC(=O)CCC(=O)CCC(=O)O

Computed by PubChem (NCBI)