CAS 1231891-86-3 appears in our catalog under these names: 3-Bromo-2-fluoro-N,N-dimethylbenzamide, 3-Bromo-2-fluoro-n,n-dimethylbenzamide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g.
3-bromo-2-fluoro-N,N-dimethylbenzamide (CAS 1231891-86-3) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 3-bromo-2-fluoro-N,N-dimethylbenzamide. InChIKey: KMXQAZGXBJULSK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 3-bromo-2-fluoro-N,N-dimethylbenzamide |
| InChIKey | KMXQAZGXBJULSK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC=C1)Br)F |
Computed by PubChem (NCBI)