Products 1231979-85-3
CAS 1231979-85-3 appears in our catalog under these names: Olopatadine nitroso-D6, Olopatadine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 1 mg.
2-[11-[3-[bis(trideuteriomethyl)amino]propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid (CAS 1231979-85-3) is a chemical compound with the molecular formula C21H23NO3 and a molecular weight of 343.4 g/mol. IUPAC name: 2-[11-[3-[bis(trideuteriomethyl)amino]propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid. InChIKey: JBIMVDZLSHOPLA-WFGJKAKNSA-N.
| Molecular formula | C21H23NO3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 2-[11-[3-[bis(trideuteriomethyl)amino]propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid |
| InChIKey | JBIMVDZLSHOPLA-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC=C1C2=CC=CC=C2COC3=C1C=C(C=C3)CC(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Olopatadine nitroso-D6