CAS 123207-39-6 appears in our catalog under these names: Ethyl 5–amino–2–fluorobenzoate, Ethyl-5-amino-2-fluorobenzoate, Ethyl 5-amino-2-fluorobenzoate 98%, Ethyl 5-Amino-2-Fluorobenzoate, 98%, 98%, Ethyl-5-amino-2-fluorobenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 2,5g, 1g, 10g.
Ethyl 5-amino-2-fluorobenzoate (CAS 123207-39-6) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: ethyl 5-amino-2-fluorobenzoate. InChIKey: NNAFCORMAIIDSV-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | ethyl 5-amino-2-fluorobenzoate |
| InChIKey | NNAFCORMAIIDSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)N)F |
Computed by PubChem (NCBI)