CAS 1232143-79-1 is the registry number for Methyl 2,6-diethynylisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,6-diethynylpyridine-4-carboxylate (CAS 1232143-79-1) is a chemical compound with the molecular formula C11H7NO2 and a molecular weight of 185.18 g/mol. IUPAC name: methyl 2,6-diethynylpyridine-4-carboxylate. InChIKey: PZFSJEJKAZEIKS-UHFFFAOYSA-N.
| Molecular formula | C11H7NO2 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | methyl 2,6-diethynylpyridine-4-carboxylate |
| InChIKey | PZFSJEJKAZEIKS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)C#C)C#C |
Computed by PubChem (NCBI)