Products 1232143-79-1

CAS 1232143-79-1 is the registry number for Methyl 2,6-diethynylisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,6-diethynylpyridine-4-carboxylate (CAS 1232143-79-1) is a chemical compound with the molecular formula C11H7NO2 and a molecular weight of 185.18 g/mol. IUPAC name: methyl 2,6-diethynylpyridine-4-carboxylate. InChIKey: PZFSJEJKAZEIKS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7NO2
Molecular weight185.18 g/mol
IUPAC namemethyl 2,6-diethynylpyridine-4-carboxylate
InChIKeyPZFSJEJKAZEIKS-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NC(=C1)C#C)C#C

Computed by PubChem (NCBI)