CAS 94734-31-3 is the registry number for Naphtho[2,3-d]isoxazol-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzo[f][1,2]benzoxazol-3-one (CAS 94734-31-3) is a chemical compound with the molecular formula C11H7NO2 and a molecular weight of 185.18 g/mol. IUPAC name: benzo[f][1,2]benzoxazol-3-one. InChIKey: DPIGZCIBDUBRBC-UHFFFAOYSA-N.
| Molecular formula | C11H7NO2 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | benzo[f][1,2]benzoxazol-3-one |
| InChIKey | DPIGZCIBDUBRBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=O)NO3 |
Computed by PubChem (NCBI)