CAS 7692-89-9 is the registry number for 2-Oxo-4-phenyl-2,5-dihydro-3-furancarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
5-oxo-3-phenyl-2H-furan-4-carbonitrile (CAS 7692-89-9) is a chemical compound with the molecular formula C11H7NO2 and a molecular weight of 185.18 g/mol. IUPAC name: 5-oxo-3-phenyl-2H-furan-4-carbonitrile. InChIKey: UVLDKEIZBJSYND-UHFFFAOYSA-N.
| Molecular formula | C11H7NO2 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 5-oxo-3-phenyl-2H-furan-4-carbonitrile |
| InChIKey | UVLDKEIZBJSYND-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C#N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)