Products 1232542-20-9

CAS 1232542-20-9 is the registry number for 5-Benzyl 7-methyl 8-oxo-5-azaspiro(2.5)octane-5,7-dicarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-O-benzyl 7-O-methyl 8-oxo-5-azaspiro[2.5]octane-5,7-dicarboxylate (CAS 1232542-20-9) is a chemical compound with the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. IUPAC name: 5-O-benzyl 7-O-methyl 8-oxo-5-azaspiro[2.5]octane-5,7-dicarboxylate. InChIKey: ZOATYAJHHSXDPC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO5
Molecular weight317.34 g/mol
IUPAC name5-O-benzyl 7-O-methyl 8-oxo-5-azaspiro[2.5]octane-5,7-dicarboxylate
InChIKeyZOATYAJHHSXDPC-UHFFFAOYSA-N
SMILESCOC(=O)C1CN(CC2(C1=O)CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)