Products 55404-20-1

CAS 55404-20-1 is the registry number for 3-Hydroxy-1-methyl-5-phenyl-1H-pyrrole-2,4-dicarboxylic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Diethyl 3-hydroxy-1-methyl-5-phenylpyrrole-2,4-dicarboxylate (CAS 55404-20-1) is a chemical compound with the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. IUPAC name: diethyl 3-hydroxy-1-methyl-5-phenylpyrrole-2,4-dicarboxylate. InChIKey: LPDGLEHUIQGFHC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO5
Molecular weight317.34 g/mol
IUPAC namediethyl 3-hydroxy-1-methyl-5-phenylpyrrole-2,4-dicarboxylate
InChIKeyLPDGLEHUIQGFHC-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(C(=C1O)C(=O)OCC)C)C2=CC=CC=C2

Computed by PubChem (NCBI)