Products 55747-45-0

CAS 55747-45-0 is the registry number for Ethyl 2-(3-phthalimidopropyl)acetoacetate. Offered by: Biosynth. Available pack sizes: 5g, 2g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate (CAS 55747-45-0) is a chemical compound with the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. IUPAC name: ethyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate. InChIKey: XDGCOSMBEZEXSN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO5
Molecular weight317.34 g/mol
IUPAC nameethyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate
InChIKeyXDGCOSMBEZEXSN-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCCN1C(=O)C2=CC=CC=C2C1=O)C(=O)C

Computed by PubChem (NCBI)