CAS 123266-62-6 is the registry number for 7–Bromo–3–methoxy–2–naphthoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
7-bromo-3-methoxynaphthalene-2-carboxylic acid (CAS 123266-62-6) is a chemical compound with the molecular formula C12H9BrO3 and a molecular weight of 281.10 g/mol. IUPAC name: 7-bromo-3-methoxynaphthalene-2-carboxylic acid. InChIKey: QUAVESQJWNBXDZ-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO3 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 7-bromo-3-methoxynaphthalene-2-carboxylic acid |
| InChIKey | QUAVESQJWNBXDZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(C=CC2=C1)Br)C(=O)O |
Computed by PubChem (NCBI)